C13H19N3O3S — CID 95136368
2-[(3R)-1,1-dioxothiolan-3-yl]-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one (PubChem CID 95136368) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one |
|---|---|
| PubChem CID | 95136368 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-7,7-dimethyl-1,5,6,8-tetrahydroimidazo[4,5-c]azepin-4-one |
| SMILES | CC1(C)CNC(=O)c2nc([C@H]3CCS(=O)(=O)C3)[nH]c2C1 |
| InChI | InChI=1S/C13H19N3O3S/c1-13(2)5-9-10(12(17)14-7-13)16-11(15-9)8-3-4-20(18,19)6-8/h8H,3-7H2,1-2H3,(H,14,17)(H,15,16)/t8-/m0/s1 |
| InChIKey | OIUSMJINSTXKKM-QMMMGPOBSA-N |
| XLogP | 0.62 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |