C13H13N5O2 — CID 95137573
(5S)-5-[(5-benzyl-1H-1,2,4-triazol-3-yl)methyl]imidazolidine-2,4-dione (PubChem CID 95137573) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is (5S)-5-[(5-benzyl-1H-1,2,4-triazol-3-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(5-benzyl-1H-1,2,4-triazol-3-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95137573 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (5S)-5-[(5-benzyl-1H-1,2,4-triazol-3-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H](Cc2n[nH]c(Cc3ccccc3)n2)N1 |
| InChI | InChI=1S/C13H13N5O2/c19-12-9(14-13(20)16-12)7-11-15-10(17-18-11)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,15,17,18)(H2,14,16,19,20)/t9-/m0/s1 |
| InChIKey | JDUSBYBFDWBQGI-VIFPVBQESA-N |
| XLogP | 0.15 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|