About (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide
(2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide (PubChem CID 95137623) has the molecular formula C13H19N5O2
and a molecular weight of 277.33 g/mol. Its IUPAC name is (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide |
| PubChem CID | 95137623 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide |
| SMILES | CN1CCc2ncnc(N3CCO[C@H](C(N)=O)C3)c2C1 |
| InChI | InChI=1S/C13H19N5O2/c1-17-3-2-10-9(6-17)13(16-8-15-10)18-4-5-20-11(7-18)12(14)19/h8,11H,2-7H2,1H3,(H2,14,19)/t11-/m0/s1 |
| InChIKey | DDIHUBOEHKYOPL-NSHDSACASA-N |
| XLogP | -0.85 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide?
The IUPAC name of (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide (CID 95137623) is (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide.
What is the SMILES notation for (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide?
The canonical SMILES for (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide is CN1CCc2ncnc(N3CCO[C@H](C(N)=O)C3)c2C1.
What is the InChIKey of (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide?
The InChIKey is DDIHUBOEHKYOPL-NSHDSACASA-N. The full InChI is InChI=1S/C13H19N5O2/c1-17-3-2-10-9(6-17)13(16-8-15-10)18-4-5-20-11(7-18)12(14)19/h8,11H,2-7H2,1H3,(H2,14,19)/t11-/m0/s1.
What are the key properties of (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide?
(2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide has a molecular weight of 277.33 g/mol, XLogP of -0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine-2-carboxamide is sourced from PubChem (CID 95137623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).