C18H19N3O4S — CID 95137977
(3S)-3-[[5-cyclopropyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-yl]methyl]-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 95137977) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is (3S)-3-[[5-cyclopropyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-yl]methyl]-2,3-dihydrothiophene 1,1-dioxide.
| Compound Name | (3S)-3-[[5-cyclopropyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-yl]methyl]-2,3-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 95137977 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (3S)-3-[[5-cyclopropyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-triazol-3-yl]methyl]-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=C[C@H](Cc2nc(C3CC3)nn2-c2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C18H19N3O4S/c22-26(23)8-5-12(11-26)9-17-19-18(13-1-2-13)20-21(17)14-3-4-15-16(10-14)25-7-6-24-15/h3-5,8,10,12-13H,1-2,6-7,9,11H2/t12-/m1/s1 |
| InChIKey | WCVVVSXCYNNJEY-GFCCVEGCSA-N |
| XLogP | 2.02 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |