About [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone
[1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 95138768) has the molecular formula C15H24N4O3
and a molecular weight of 308.38 g/mol. Its IUPAC name is [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone |
| PubChem CID | 95138768 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1nnc([C@H](C)N2CCC(C(=O)N3CCOCC3)CC2)o1 |
| InChI | InChI=1S/C15H24N4O3/c1-11(14-17-16-12(2)22-14)18-5-3-13(4-6-18)15(20)19-7-9-21-10-8-19/h11,13H,3-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | GQDHQJYXNUVDPB-NSHDSACASA-N |
| XLogP | 1.01 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone?
The IUPAC name of [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone (CID 95138768) is [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone is Cc1nnc([C@H](C)N2CCC(C(=O)N3CCOCC3)CC2)o1.
What is the InChIKey of [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone?
The InChIKey is GQDHQJYXNUVDPB-NSHDSACASA-N. The full InChI is InChI=1S/C15H24N4O3/c1-11(14-17-16-12(2)22-14)18-5-3-13(4-6-18)15(20)19-7-9-21-10-8-19/h11,13H,3-10H2,1-2H3/t11-/m0/s1.
What are the key properties of [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone?
[1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone has a molecular weight of 308.38 g/mol, XLogP of 1.01, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1S)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]piperidin-4-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 95138768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).