C12H16F3N3O2 — CID 95139612
(2R)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-2-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 95139612) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is (2R)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-2-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | (2R)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-2-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 95139612 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (2R)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-2-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | C[C@@H](OCC(F)(F)F)C(=O)N[C@@H]1CCc2nccn2C1 |
| InChI | InChI=1S/C12H16F3N3O2/c1-8(20-7-12(13,14)15)11(19)17-9-2-3-10-16-4-5-18(10)6-9/h4-5,8-9H,2-3,6-7H2,1H3,(H,17,19)/t8-,9-/m1/s1 |
| InChIKey | IRHWCUOWTXDWKD-RKDXNWHRSA-N |
| XLogP | 1.28 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |