About 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone
2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone (PubChem CID 95139873) has the molecular formula C16H21N3OS
and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone |
| PubChem CID | 95139873 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone |
| SMILES | CC(C)c1nc(CC(=O)N2CCC[C@H]2c2ccc[nH]2)cs1 |
| InChI | InChI=1S/C16H21N3OS/c1-11(2)16-18-12(10-21-16)9-15(20)19-8-4-6-14(19)13-5-3-7-17-13/h3,5,7,10-11,14,17H,4,6,8-9H2,1-2H3/t14-/m0/s1 |
| InChIKey | SIBGSMCJSNMSHD-AWEZNQCLSA-N |
| XLogP | 3.50 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone?
The IUPAC name of 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone (CID 95139873) is 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone.
What is the SMILES notation for 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone?
The canonical SMILES for 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone is CC(C)c1nc(CC(=O)N2CCC[C@H]2c2ccc[nH]2)cs1.
What is the InChIKey of 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone?
The InChIKey is SIBGSMCJSNMSHD-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H21N3OS/c1-11(2)16-18-12(10-21-16)9-15(20)19-8-4-6-14(19)13-5-3-7-17-13/h3,5,7,10-11,14,17H,4,6,8-9H2,1-2H3/t14-/m0/s1.
What are the key properties of 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone?
2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone has a molecular weight of 303.43 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-propan-2-yl-1,3-thiazol-4-yl)-1-[(2S)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone is sourced from PubChem (CID 95139873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).