C19H29N3O3 — CID 95140732
3-methyl-N-[(1R)-2-(2-morpholin-4-ylethylamino)-2-oxo-1-phenylethyl]butanamide (PubChem CID 95140732) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-methyl-N-[(1R)-2-(2-morpholin-4-ylethylamino)-2-oxo-1-phenylethyl]butanamide.
| Compound Name | 3-methyl-N-[(1R)-2-(2-morpholin-4-ylethylamino)-2-oxo-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 95140732 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 3-methyl-N-[(1R)-2-(2-morpholin-4-ylethylamino)-2-oxo-1-phenylethyl]butanamide |
| SMILES | CC(C)CC(=O)N[C@@H](C(=O)NCCN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C19H29N3O3/c1-15(2)14-17(23)21-18(16-6-4-3-5-7-16)19(24)20-8-9-22-10-12-25-13-11-22/h3-7,15,18H,8-14H2,1-2H3,(H,20,24)(H,21,23)/t18-/m1/s1 |
| InChIKey | CZEOPGMIQDJOJH-GOSISDBHSA-N |
| XLogP | 1.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |