About N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide
N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide (PubChem CID 95141117) has the molecular formula C15H13F2N5OS
and a molecular weight of 349.37 g/mol. Its IUPAC name is N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide |
| PubChem CID | 95141117 |
| Molecular Formula | C15H13F2N5OS |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide |
| SMILES | CCc1ccsc1C(=O)N[C@H](c1nn[nH]n1)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H13F2N5OS/c1-2-8-5-6-24-13(8)15(23)18-12(14-19-21-22-20-14)10-7-9(16)3-4-11(10)17/h3-7,12H,2H2,1H3,(H,18,23)(H,19,20,21,22)/t12-/m0/s1 |
| InChIKey | OFGOWJFRFWAOKN-LBPRGKRZSA-N |
| XLogP | 2.62 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide?
The IUPAC name of N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide (CID 95141117) is N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide.
What is the SMILES notation for N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide?
The canonical SMILES for N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide is CCc1ccsc1C(=O)N[C@H](c1nn[nH]n1)c1cc(F)ccc1F.
What is the InChIKey of N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide?
The InChIKey is OFGOWJFRFWAOKN-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H13F2N5OS/c1-2-8-5-6-24-13(8)15(23)18-12(14-19-21-22-20-14)10-7-9(16)3-4-11(10)17/h3-7,12H,2H2,1H3,(H,18,23)(H,19,20,21,22)/t12-/m0/s1.
What are the key properties of N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide?
N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide has a molecular weight of 349.37 g/mol, XLogP of 2.62, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(S)-(2,5-difluorophenyl)-(2H-tetrazol-5-yl)methyl]-3-ethylthiophene-2-carboxamide is sourced from PubChem (CID 95141117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).