About ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate
ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate (PubChem CID 95142058) has the molecular formula C13H21N3O2
and a molecular weight of 251.33 g/mol. Its IUPAC name is ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate.
Molecular Properties
| Compound Name | ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate |
| PubChem CID | 95142058 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate |
| SMILES | CCOC(=O)[C@@H](c1n[nH]c(C)n1)C1CCCCC1 |
| InChI | InChI=1S/C13H21N3O2/c1-3-18-13(17)11(10-7-5-4-6-8-10)12-14-9(2)15-16-12/h10-11H,3-8H2,1-2H3,(H,14,15,16)/t11-/m1/s1 |
| InChIKey | FSIRALSCBXKCJG-LLVKDONJSA-N |
| XLogP | 2.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate?
The IUPAC name of ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate (CID 95142058) is ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate.
What is the SMILES notation for ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate?
The canonical SMILES for ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate is CCOC(=O)[C@@H](c1n[nH]c(C)n1)C1CCCCC1.
What is the InChIKey of ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate?
The InChIKey is FSIRALSCBXKCJG-LLVKDONJSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-3-18-13(17)11(10-7-5-4-6-8-10)12-14-9(2)15-16-12/h10-11H,3-8H2,1-2H3,(H,14,15,16)/t11-/m1/s1.
What are the key properties of ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate?
ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate has a molecular weight of 251.33 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-cyclohexyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetate is sourced from PubChem (CID 95142058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).