C13H19N5O2S2 — CID 95142678
(9aS)-2-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one (PubChem CID 95142678) has the molecular formula C13H19N5O2S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (9aS)-2-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one.
| Compound Name | (9aS)-2-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 95142678 |
| Molecular Formula | C13H19N5O2S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (9aS)-2-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one |
| SMILES | Cc1nnc(SCCC(=O)N2CCN3CCNC(=O)[C@@H]3C2)s1 |
| InChI | InChI=1S/C13H19N5O2S2/c1-9-15-16-13(22-9)21-7-2-11(19)18-6-5-17-4-3-14-12(20)10(17)8-18/h10H,2-8H2,1H3,(H,14,20)/t10-/m0/s1 |
| InChIKey | PCYXPGQPSRRMSY-JTQLQIEISA-N |
| XLogP | -0.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |