C10H18N4S — CID 95142978
N-[(1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]thian-4-amine (PubChem CID 95142978) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is N-[(1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]thian-4-amine.
| Compound Name | N-[(1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]thian-4-amine |
|---|---|
| PubChem CID | 95142978 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-[(1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]thian-4-amine |
| SMILES | Cc1nc([C@H](C)NC2CCSCC2)n[nH]1 |
| InChI | InChI=1S/C10H18N4S/c1-7(10-12-8(2)13-14-10)11-9-3-5-15-6-4-9/h7,9,11H,3-6H2,1-2H3,(H,12,13,14)/t7-/m0/s1 |
| InChIKey | KKPNGPZJKBJAJP-ZETCQYMHSA-N |
| XLogP | 1.66 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |