About 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide
2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide (PubChem CID 95143146) has the molecular formula C18H23N3OS
and a molecular weight of 329.47 g/mol. Its IUPAC name is 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide |
| PubChem CID | 95143146 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)CN(Cc2cncs2)C2CC2)cc1 |
| InChI | InChI=1S/C18H23N3OS/c1-13-3-5-15(6-4-13)14(2)20-18(22)11-21(16-7-8-16)10-17-9-19-12-23-17/h3-6,9,12,14,16H,7-8,10-11H2,1-2H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | ISTFYRGPASEAIO-CQSZACIVSA-N |
| XLogP | 3.29 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide?
The IUPAC name of 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide (CID 95143146) is 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide.
What is the SMILES notation for 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide?
The canonical SMILES for 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide is Cc1ccc([C@@H](C)NC(=O)CN(Cc2cncs2)C2CC2)cc1.
What is the InChIKey of 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide?
The InChIKey is ISTFYRGPASEAIO-CQSZACIVSA-N. The full InChI is InChI=1S/C18H23N3OS/c1-13-3-5-15(6-4-13)14(2)20-18(22)11-21(16-7-8-16)10-17-9-19-12-23-17/h3-6,9,12,14,16H,7-8,10-11H2,1-2H3,(H,20,22)/t14-/m1/s1.
What are the key properties of 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide?
2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide has a molecular weight of 329.47 g/mol, XLogP of 3.29, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]-N-[(1R)-1-(4-methylphenyl)ethyl]acetamide is sourced from PubChem (CID 95143146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).