C17H25FN2O2 — CID 95144039
(2S)-N-[(2-fluorophenyl)methyl]-N-(2-hydroxyethyl)-1-methylazepane-2-carboxamide (PubChem CID 95144039) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is (2S)-N-[(2-fluorophenyl)methyl]-N-(2-hydroxyethyl)-1-methylazepane-2-carboxamide.
| Compound Name | (2S)-N-[(2-fluorophenyl)methyl]-N-(2-hydroxyethyl)-1-methylazepane-2-carboxamide |
|---|---|
| PubChem CID | 95144039 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (2S)-N-[(2-fluorophenyl)methyl]-N-(2-hydroxyethyl)-1-methylazepane-2-carboxamide |
| SMILES | CN1CCCCC[C@H]1C(=O)N(CCO)Cc1ccccc1F |
| InChI | InChI=1S/C17H25FN2O2/c1-19-10-6-2-3-9-16(19)17(22)20(11-12-21)13-14-7-4-5-8-15(14)18/h4-5,7-8,16,21H,2-3,6,9-13H2,1H3/t16-/m0/s1 |
| InChIKey | JLDVZMGMGWBMKC-INIZCTEOSA-N |
| XLogP | 2.02 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |