C21H23N3O3 — CID 95144233
(4S)-4-[(E)-1-(furan-2-yl)prop-1-en-2-yl]-2-oxo-7-pyrrolidin-1-yl-3,4-dihydro-1H-quinoline-6-carboxamide (PubChem CID 95144233) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (4S)-4-[(E)-1-(furan-2-yl)prop-1-en-2-yl]-2-oxo-7-pyrrolidin-1-yl-3,4-dihydro-1H-quinoline-6-carboxamide.
| Compound Name | (4S)-4-[(E)-1-(furan-2-yl)prop-1-en-2-yl]-2-oxo-7-pyrrolidin-1-yl-3,4-dihydro-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 95144233 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (4S)-4-[(E)-1-(furan-2-yl)prop-1-en-2-yl]-2-oxo-7-pyrrolidin-1-yl-3,4-dihydro-1H-quinoline-6-carboxamide |
| SMILES | C/C(=C\c1ccco1)[C@@H]1CC(=O)Nc2cc(N3CCCC3)c(C(N)=O)cc21 |
| InChI | InChI=1S/C21H23N3O3/c1-13(9-14-5-4-8-27-14)15-11-20(25)23-18-12-19(24-6-2-3-7-24)17(21(22)26)10-16(15)18/h4-5,8-10,12,15H,2-3,6-7,11H2,1H3,(H2,22,26)(H,23,25)/b13-9+/t15-/m0/s1 |
| InChIKey | DRHZRJHJYRXXOG-GLNPCMGASA-N |
| XLogP | 3.51 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|