C19H16N4O3S — CID 95144264
(9R)-9-(2,1,3-benzothiadiazol-4-yl)-4-ethyl-8,9-dihydro-6H-pyrido[2,3-g][1,4]benzoxazine-3,7-dione (PubChem CID 95144264) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is (9R)-9-(2,1,3-benzothiadiazol-4-yl)-4-ethyl-8,9-dihydro-6H-pyrido[2,3-g][1,4]benzoxazine-3,7-dione.
| Compound Name | (9R)-9-(2,1,3-benzothiadiazol-4-yl)-4-ethyl-8,9-dihydro-6H-pyrido[2,3-g][1,4]benzoxazine-3,7-dione |
|---|---|
| PubChem CID | 95144264 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (9R)-9-(2,1,3-benzothiadiazol-4-yl)-4-ethyl-8,9-dihydro-6H-pyrido[2,3-g][1,4]benzoxazine-3,7-dione |
| SMILES | CCN1C(=O)COc2cc3c(cc21)NC(=O)C[C@H]3c1cccc2nsnc12 |
| InChI | InChI=1S/C19H16N4O3S/c1-2-23-15-8-14-12(6-16(15)26-9-18(23)25)11(7-17(24)20-14)10-4-3-5-13-19(10)22-27-21-13/h3-6,8,11H,2,7,9H2,1H3,(H,20,24)/t11-/m0/s1 |
| InChIKey | MCDMPIMHTLPBEY-NSHDSACASA-N |
| XLogP | 2.91 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |