C15H17N5O2 — CID 95144362
(5S)-5-[2-[3-(2-phenylethyl)-1H-1,2,4-triazol-5-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 95144362) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is (5S)-5-[2-[3-(2-phenylethyl)-1H-1,2,4-triazol-5-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[2-[3-(2-phenylethyl)-1H-1,2,4-triazol-5-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95144362 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (5S)-5-[2-[3-(2-phenylethyl)-1H-1,2,4-triazol-5-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H](CCc2nc(CCc3ccccc3)n[nH]2)N1 |
| InChI | InChI=1S/C15H17N5O2/c21-14-11(16-15(22)18-14)7-9-13-17-12(19-20-13)8-6-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,17,19,20)(H2,16,18,21,22)/t11-/m0/s1 |
| InChIKey | NUPPWFDMFDFYAN-NSHDSACASA-N |
| XLogP | 0.73 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|