C17H18ClN3O2 — CID 95145263
N-(2-chloro-3-pyridinyl)-2-[(2R)-2-(4-hydroxyphenyl)pyrrolidin-1-yl]acetamide (PubChem CID 95145263) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[(2R)-2-(4-hydroxyphenyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[(2R)-2-(4-hydroxyphenyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 95145263 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[(2R)-2-(4-hydroxyphenyl)pyrrolidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC[C@@H]1c1ccc(O)cc1)Nc1cccnc1Cl |
| InChI | InChI=1S/C17H18ClN3O2/c18-17-14(3-1-9-19-17)20-16(23)11-21-10-2-4-15(21)12-5-7-13(22)8-6-12/h1,3,5-9,15,22H,2,4,10-11H2,(H,20,23)/t15-/m1/s1 |
| InChIKey | KEPZQFLXKYAOAS-OAHLLOKOSA-N |
| XLogP | 3.22 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|