C20H21N3O2 — CID 95145430
N-cyclopropyl-6-methoxy-N-[(1R)-1-pyridin-3-ylethyl]-1H-indole-2-carboxamide (PubChem CID 95145430) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-cyclopropyl-6-methoxy-N-[(1R)-1-pyridin-3-ylethyl]-1H-indole-2-carboxamide.
| Compound Name | N-cyclopropyl-6-methoxy-N-[(1R)-1-pyridin-3-ylethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 95145430 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-cyclopropyl-6-methoxy-N-[(1R)-1-pyridin-3-ylethyl]-1H-indole-2-carboxamide |
| SMILES | COc1ccc2cc(C(=O)N(C3CC3)[C@H](C)c3cccnc3)[nH]c2c1 |
| InChI | InChI=1S/C20H21N3O2/c1-13(15-4-3-9-21-12-15)23(16-6-7-16)20(24)19-10-14-5-8-17(25-2)11-18(14)22-19/h3-5,8-13,16,22H,6-7H2,1-2H3/t13-/m1/s1 |
| InChIKey | RJMLNVHGHHCQRL-CYBMUJFWSA-N |
| XLogP | 3.94 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |