C20H29F2N3O2 — CID 95145560
N'-(3,4-difluorophenyl)-N-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]butyl]-N'-methyloxamide (PubChem CID 95145560) has the molecular formula C20H29F2N3O2 and a molecular weight of 381.47 g/mol. Its IUPAC name is N'-(3,4-difluorophenyl)-N-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]butyl]-N'-methyloxamide.
| Compound Name | N'-(3,4-difluorophenyl)-N-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]butyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 95145560 |
| Molecular Formula | C20H29F2N3O2 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N'-(3,4-difluorophenyl)-N-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]butyl]-N'-methyloxamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCCNC(=O)C(=O)N(C)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C20H29F2N3O2/c1-14-10-15(2)13-25(12-14)9-5-4-8-23-19(26)20(27)24(3)16-6-7-17(21)18(22)11-16/h6-7,11,14-15H,4-5,8-10,12-13H2,1-3H3,(H,23,26)/t14-,15-/m1/s1 |
| InChIKey | ZZUVFHRDCSSFKF-HUUCEWRRSA-N |
| XLogP | 2.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|