C18H20N2O3S — CID 95146458
4-(sulfamoylmethyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide (PubChem CID 95146458) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-(sulfamoylmethyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide.
| Compound Name | 4-(sulfamoylmethyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 95146458 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-(sulfamoylmethyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
| SMILES | NS(=O)(=O)Cc1ccc(C(=O)N[C@@H]2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H20N2O3S/c19-24(22,23)12-13-8-10-15(11-9-13)18(21)20-17-7-3-5-14-4-1-2-6-16(14)17/h1-2,4,6,8-11,17H,3,5,7,12H2,(H,20,21)(H2,19,22,23)/t17-/m1/s1 |
| InChIKey | JWLTZLMDLGTDMT-QGZVFWFLSA-N |
| XLogP | 2.28 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |