About methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate
methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate (PubChem CID 95146974) has the molecular formula C16H20N2O5
and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate |
| PubChem CID | 95146974 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(Cc2cccc3c2OCO3)[C@@H](C)C1=O |
| InChI | InChI=1S/C16H20N2O5/c1-11-16(20)18(9-14(19)21-2)7-6-17(11)8-12-4-3-5-13-15(12)23-10-22-13/h3-5,11H,6-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | RYHOJGUITYDETC-NSHDSACASA-N |
| XLogP | 0.62 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate?
The IUPAC name of methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate (CID 95146974) is methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate.
What is the SMILES notation for methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate?
The canonical SMILES for methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate is COC(=O)CN1CCN(Cc2cccc3c2OCO3)[C@@H](C)C1=O.
What is the InChIKey of methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate?
The InChIKey is RYHOJGUITYDETC-NSHDSACASA-N. The full InChI is InChI=1S/C16H20N2O5/c1-11-16(20)18(9-14(19)21-2)7-6-17(11)8-12-4-3-5-13-15(12)23-10-22-13/h3-5,11H,6-10H2,1-2H3/t11-/m0/s1.
What are the key properties of methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate?
methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate has a molecular weight of 320.35 g/mol, XLogP of 0.62, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3S)-4-(1,3-benzodioxol-4-ylmethyl)-3-methyl-2-oxopiperazin-1-yl]acetate is sourced from PubChem (CID 95146974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).