C16H19N3O3 — CID 95147907
(2R)-2-[4-(4-acetyl-3,5-dimethylpyrazol-1-yl)phenoxy]propanamide (PubChem CID 95147907) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (2R)-2-[4-(4-acetyl-3,5-dimethylpyrazol-1-yl)phenoxy]propanamide.
| Compound Name | (2R)-2-[4-(4-acetyl-3,5-dimethylpyrazol-1-yl)phenoxy]propanamide |
|---|---|
| PubChem CID | 95147907 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (2R)-2-[4-(4-acetyl-3,5-dimethylpyrazol-1-yl)phenoxy]propanamide |
| SMILES | CC(=O)c1c(C)nn(-c2ccc(O[C@H](C)C(N)=O)cc2)c1C |
| InChI | InChI=1S/C16H19N3O3/c1-9-15(11(3)20)10(2)19(18-9)13-5-7-14(8-6-13)22-12(4)16(17)21/h5-8,12H,1-4H3,(H2,17,21)/t12-/m1/s1 |
| InChIKey | KEGGFUQPMRTNDV-GFCCVEGCSA-N |
| XLogP | 1.94 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |