C22H20N4S — CID 95148833
5-[[(3R)-3-[2-(1-benzothiophen-3-yl)-4-pyridinyl]pyrrolidin-1-yl]methyl]pyrimidine (PubChem CID 95148833) has the molecular formula C22H20N4S and a molecular weight of 372.50 g/mol. Its IUPAC name is 5-[[(3R)-3-[2-(1-benzothiophen-3-yl)-4-pyridinyl]pyrrolidin-1-yl]methyl]pyrimidine.
| Compound Name | 5-[[(3R)-3-[2-(1-benzothiophen-3-yl)-4-pyridinyl]pyrrolidin-1-yl]methyl]pyrimidine |
|---|---|
| PubChem CID | 95148833 |
| Molecular Formula | C22H20N4S |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 5-[[(3R)-3-[2-(1-benzothiophen-3-yl)-4-pyridinyl]pyrrolidin-1-yl]methyl]pyrimidine |
| SMILES | c1ccc2c(-c3cc([C@H]4CCN(Cc5cncnc5)C4)ccn3)csc2c1 |
| InChI | InChI=1S/C22H20N4S/c1-2-4-22-19(3-1)20(14-27-22)21-9-17(5-7-25-21)18-6-8-26(13-18)12-16-10-23-15-24-11-16/h1-5,7,9-11,14-15,18H,6,8,12-13H2/t18-/m0/s1 |
| InChIKey | WEYJNLLIISASLB-SFHVURJKSA-N |
| XLogP | 4.74 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |