About (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one
(7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one (PubChem CID 95148904) has the molecular formula C19H20N2O4S
and a molecular weight of 372.45 g/mol. Its IUPAC name is (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one |
| PubChem CID | 95148904 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one |
| SMILES | CS(=O)(=O)c1cccc(C(=O)N2CCNC(=O)C[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O4S/c1-26(24,25)16-9-5-8-15(12-16)19(23)21-11-10-20-18(22)13-17(21)14-6-3-2-4-7-14/h2-9,12,17H,10-11,13H2,1H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | YOBFHWCNRRQUGW-KRWDZBQOSA-N |
| XLogP | 1.79 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one?
The IUPAC name of (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one (CID 95148904) is (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one.
What is the SMILES notation for (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one?
The canonical SMILES for (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one is CS(=O)(=O)c1cccc(C(=O)N2CCNC(=O)C[C@H]2c2ccccc2)c1.
What is the InChIKey of (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one?
The InChIKey is YOBFHWCNRRQUGW-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H20N2O4S/c1-26(24,25)16-9-5-8-15(12-16)19(23)21-11-10-20-18(22)13-17(21)14-6-3-2-4-7-14/h2-9,12,17H,10-11,13H2,1H3,(H,20,22)/t17-/m0/s1.
What are the key properties of (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one?
(7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one has a molecular weight of 372.45 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-1-(3-methylsulfonylbenzoyl)-7-phenyl-1,4-diazepan-5-one is sourced from PubChem (CID 95148904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).