C18H25N3O2S — CID 95149005
N-(4-methylphenyl)-2-[(2S)-2-(thiomorpholine-4-carbonyl)pyrrolidin-1-yl]acetamide (PubChem CID 95149005) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[(2S)-2-(thiomorpholine-4-carbonyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[(2S)-2-(thiomorpholine-4-carbonyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 95149005 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-(4-methylphenyl)-2-[(2S)-2-(thiomorpholine-4-carbonyl)pyrrolidin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCC[C@H]2C(=O)N2CCSCC2)cc1 |
| InChI | InChI=1S/C18H25N3O2S/c1-14-4-6-15(7-5-14)19-17(22)13-21-8-2-3-16(21)18(23)20-9-11-24-12-10-20/h4-7,16H,2-3,8-13H2,1H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | SSNOIDBEYAVGJX-INIZCTEOSA-N |
| XLogP | 1.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |