C17H22ClN3O2 — CID 95149279
5-[(3R)-1-[3-(3-chlorophenoxy)propyl]piperidin-3-yl]-3-methyl-1,2,4-oxadiazole (PubChem CID 95149279) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.83 g/mol. Its IUPAC name is 5-[(3R)-1-[3-(3-chlorophenoxy)propyl]piperidin-3-yl]-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-[(3R)-1-[3-(3-chlorophenoxy)propyl]piperidin-3-yl]-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 95149279 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 5-[(3R)-1-[3-(3-chlorophenoxy)propyl]piperidin-3-yl]-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc([C@@H]2CCCN(CCCOc3cccc(Cl)c3)C2)n1 |
| InChI | InChI=1S/C17H22ClN3O2/c1-13-19-17(23-20-13)14-5-3-8-21(12-14)9-4-10-22-16-7-2-6-15(18)11-16/h2,6-7,11,14H,3-5,8-10,12H2,1H3/t14-/m1/s1 |
| InChIKey | KOPLPDJWYUYXSA-CQSZACIVSA-N |
| XLogP | 3.68 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|