C15H20F3N3O — CID 95149733
cis-(1R,3S)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 95149733) has the molecular formula C15H20F3N3O and a molecular weight of 315.34 g/mol. Its IUPAC name is cis-(1R,3S)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,3S)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 95149733 |
| Molecular Formula | C15H20F3N3O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | cis-(1R,3S)-N-[(6R)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(N[C@@H]1CCc2nccn2C1)[C@@H]1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C15H20F3N3O/c16-15(17,18)11-3-1-2-10(8-11)14(22)20-12-4-5-13-19-6-7-21(13)9-12/h6-7,10-12H,1-5,8-9H2,(H,20,22)/t10-,11+,12-/m1/s1 |
| InChIKey | KYSXNVXJRMWWRR-GRYCIOLGSA-N |
| XLogP | 2.68 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |