C14H18ClN3O3 — CID 95151348
N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide (PubChem CID 95151348) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide.
| Compound Name | N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 95151348 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)NCC(N)=O |
| InChI | InChI=1S/C14H18ClN3O3/c1-8(2)12(14(21)17-7-11(16)19)18-13(20)9-3-5-10(15)6-4-9/h3-6,8,12H,7H2,1-2H3,(H2,16,19)(H,17,21)(H,18,20)/t12-/m0/s1 |
| InChIKey | PXEIPVWJVCLZJI-LBPRGKRZSA-N |
| XLogP | 0.70 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |