C14H20Cl2N2O3S — CID 95151522
N-[3-[[(1S,2S)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]propyl]methanesulfonamide (PubChem CID 95151522) has the molecular formula C14H20Cl2N2O3S and a molecular weight of 367.30 g/mol. Its IUPAC name is N-[3-[[(1S,2S)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]propyl]methanesulfonamide.
| Compound Name | N-[3-[[(1S,2S)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 95151522 |
| Molecular Formula | C14H20Cl2N2O3S |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-[3-[[(1S,2S)-4,6-dichloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-methylamino]propyl]methanesulfonamide |
| SMILES | CN(CCCNS(C)(=O)=O)[C@H]1c2cc(Cl)cc(Cl)c2C[C@@H]1O |
| InChI | InChI=1S/C14H20Cl2N2O3S/c1-18(5-3-4-17-22(2,20)21)14-11-6-9(15)7-12(16)10(11)8-13(14)19/h6-7,13-14,17,19H,3-5,8H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | BLNFMKJPYWYLMH-KBPBESRZSA-N |
| XLogP | 1.82 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|