C15H22FN3O2 — CID 95151911
N-(2-fluorophenyl)-4-[(2R)-1-methoxypropan-2-yl]piperazine-1-carboxamide (PubChem CID 95151911) has the molecular formula C15H22FN3O2 and a molecular weight of 295.36 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-[(2R)-1-methoxypropan-2-yl]piperazine-1-carboxamide.
| Compound Name | N-(2-fluorophenyl)-4-[(2R)-1-methoxypropan-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 95151911 |
| Molecular Formula | C15H22FN3O2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-(2-fluorophenyl)-4-[(2R)-1-methoxypropan-2-yl]piperazine-1-carboxamide |
| SMILES | COC[C@@H](C)N1CCN(C(=O)Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C15H22FN3O2/c1-12(11-21-2)18-7-9-19(10-8-18)15(20)17-14-6-4-3-5-13(14)16/h3-6,12H,7-11H2,1-2H3,(H,17,20)/t12-/m1/s1 |
| InChIKey | GFLSDDDMTROUCQ-GFCCVEGCSA-N |
| XLogP | 2.01 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |