C18H24N4O — CID 95152320
1-[(2S)-butan-2-yl]-6-methyl-N,N-bis(prop-2-enyl)pyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 95152320) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-6-methyl-N,N-bis(prop-2-enyl)pyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | 1-[(2S)-butan-2-yl]-6-methyl-N,N-bis(prop-2-enyl)pyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 95152320 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-6-methyl-N,N-bis(prop-2-enyl)pyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1cc(C)nc2c1cnn2[C@@H](C)CC |
| InChI | InChI=1S/C18H24N4O/c1-6-9-21(10-7-2)18(23)15-11-13(4)20-17-16(15)12-19-22(17)14(5)8-3/h6-7,11-12,14H,1-2,8-10H2,3-5H3/t14-/m0/s1 |
| InChIKey | WIWREXIVXJFOEC-AWEZNQCLSA-N |
| XLogP | 3.52 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|