C17H23N3O3S — CID 95152799
(4S)-N'-(2-methylbenzoyl)-3-[(2R)-2-methylbutanoyl]-1,3-thiazolidine-4-carbohydrazide (PubChem CID 95152799) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is (4S)-N'-(2-methylbenzoyl)-3-[(2R)-2-methylbutanoyl]-1,3-thiazolidine-4-carbohydrazide.
| Compound Name | (4S)-N'-(2-methylbenzoyl)-3-[(2R)-2-methylbutanoyl]-1,3-thiazolidine-4-carbohydrazide |
|---|---|
| PubChem CID | 95152799 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (4S)-N'-(2-methylbenzoyl)-3-[(2R)-2-methylbutanoyl]-1,3-thiazolidine-4-carbohydrazide |
| SMILES | CC[C@@H](C)C(=O)N1CSC[C@@H]1C(=O)NNC(=O)c1ccccc1C |
| InChI | InChI=1S/C17H23N3O3S/c1-4-11(2)17(23)20-10-24-9-14(20)16(22)19-18-15(21)13-8-6-5-7-12(13)3/h5-8,11,14H,4,9-10H2,1-3H3,(H,18,21)(H,19,22)/t11-,14-/m1/s1 |
| InChIKey | JYRFCYSOYDQMKC-BXUZGUMPSA-N |
| XLogP | 1.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|