C8H18N2O3S — CID 95154399
(2R)-2-ethyl-N,N-dimethylmorpholine-4-sulfonamide (PubChem CID 95154399) has the molecular formula C8H18N2O3S and a molecular weight of 222.31 g/mol. Its IUPAC name is (2R)-2-ethyl-N,N-dimethylmorpholine-4-sulfonamide.
| Compound Name | (2R)-2-ethyl-N,N-dimethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 95154399 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (2R)-2-ethyl-N,N-dimethylmorpholine-4-sulfonamide |
| SMILES | CC[C@@H]1CN(S(=O)(=O)N(C)C)CCO1 |
| InChI | InChI=1S/C8H18N2O3S/c1-4-8-7-10(5-6-13-8)14(11,12)9(2)3/h8H,4-7H2,1-3H3/t8-/m1/s1 |
| InChIKey | YVFXOSQSQHCMKO-MRVPVSSYSA-N |
| XLogP | -0.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |