C15H26N2O2S — CID 95156131
N-cyclopropyl-N-[(2R,3R)-3-methylpentan-2-yl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide (PubChem CID 95156131) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2R,3R)-3-methylpentan-2-yl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide.
| Compound Name | N-cyclopropyl-N-[(2R,3R)-3-methylpentan-2-yl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 95156131 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-cyclopropyl-N-[(2R,3R)-3-methylpentan-2-yl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
| SMILES | CC[C@@H](C)[C@@H](C)N(C(=O)CCN1CCSC1=O)C1CC1 |
| InChI | InChI=1S/C15H26N2O2S/c1-4-11(2)12(3)17(13-5-6-13)14(18)7-8-16-9-10-20-15(16)19/h11-13H,4-10H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | IOWQDLSFBASBCW-VXGBXAGGSA-N |
| XLogP | 2.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|