C14H21F3N2O2S — CID 95156303
(3R)-4,4,4-trifluoro-3-hydroxy-N-(4-methylpentyl)-3-(4-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 95156303) has the molecular formula C14H21F3N2O2S and a molecular weight of 338.40 g/mol. Its IUPAC name is (3R)-4,4,4-trifluoro-3-hydroxy-N-(4-methylpentyl)-3-(4-methyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | (3R)-4,4,4-trifluoro-3-hydroxy-N-(4-methylpentyl)-3-(4-methyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 95156303 |
| Molecular Formula | C14H21F3N2O2S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (3R)-4,4,4-trifluoro-3-hydroxy-N-(4-methylpentyl)-3-(4-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1csc([C@@](O)(CC(=O)NCCCC(C)C)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H21F3N2O2S/c1-9(2)5-4-6-18-11(20)7-13(21,14(15,16)17)12-19-10(3)8-22-12/h8-9,21H,4-7H2,1-3H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | XWFQDFAOLJEYAE-ZDUSSCGKSA-N |
| XLogP | 3.14 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|