C14H19NO4S — CID 95156522
3-[[(S)-methylsulfinyl]methyl]-N-[(2S)-oxan-2-yl]oxybenzamide (PubChem CID 95156522) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-[[(S)-methylsulfinyl]methyl]-N-[(2S)-oxan-2-yl]oxybenzamide.
| Compound Name | 3-[[(S)-methylsulfinyl]methyl]-N-[(2S)-oxan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 95156522 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-[[(S)-methylsulfinyl]methyl]-N-[(2S)-oxan-2-yl]oxybenzamide |
| SMILES | C[S@](=O)Cc1cccc(C(=O)NO[C@H]2CCCCO2)c1 |
| InChI | InChI=1S/C14H19NO4S/c1-20(17)10-11-5-4-6-12(9-11)14(16)15-19-13-7-2-3-8-18-13/h4-6,9,13H,2-3,7-8,10H2,1H3,(H,15,16)/t13-,20-/m0/s1 |
| InChIKey | JZOLDWUPUCGOLV-RBZFPXEDSA-N |
| XLogP | 1.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|