C17H25N3O3 — CID 95156797
(2R)-2-acetamido-N-(4-butylphenyl)pentanediamide (PubChem CID 95156797) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is (2R)-2-acetamido-N-(4-butylphenyl)pentanediamide.
| Compound Name | (2R)-2-acetamido-N-(4-butylphenyl)pentanediamide |
|---|---|
| PubChem CID | 95156797 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (2R)-2-acetamido-N-(4-butylphenyl)pentanediamide |
| SMILES | CCCCc1ccc(NC(=O)[C@@H](CCC(N)=O)NC(C)=O)cc1 |
| InChI | InChI=1S/C17H25N3O3/c1-3-4-5-13-6-8-14(9-7-13)20-17(23)15(19-12(2)21)10-11-16(18)22/h6-9,15H,3-5,10-11H2,1-2H3,(H2,18,22)(H,19,21)(H,20,23)/t15-/m1/s1 |
| InChIKey | TWYGRXOBOAKBNO-OAHLLOKOSA-N |
| XLogP | 1.74 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |