C19H26N2O — CID 95157079
[(9aR)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanone (PubChem CID 95157079) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is [(9aR)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanone.
| Compound Name | [(9aR)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanone |
|---|---|
| PubChem CID | 95157079 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | [(9aR)-1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl]-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methanone |
| SMILES | O=C([C@H]1CCCc2ccccc21)N1CCCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C19H26N2O/c22-19(18-10-3-7-15-6-1-2-9-17(15)18)21-13-5-12-20-11-4-8-16(20)14-21/h1-2,6,9,16,18H,3-5,7-8,10-14H2/t16-,18+/m1/s1 |
| InChIKey | WOKFBZXQLBMJOX-AEFFLSMTSA-N |
| XLogP | 2.80 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |