About (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one
(3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one (PubChem CID 95157382) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one.
Molecular Properties
| Compound Name | (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one |
| PubChem CID | 95157382 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one |
| SMILES | C[C@H]1C(=O)NCCN1Cc1nnc(C(C)(C)C)o1 |
| InChI | InChI=1S/C12H20N4O2/c1-8-10(17)13-5-6-16(8)7-9-14-15-11(18-9)12(2,3)4/h8H,5-7H2,1-4H3,(H,13,17)/t8-/m0/s1 |
| InChIKey | XGNVYBOVWUJOIX-QMMMGPOBSA-N |
| XLogP | 0.69 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one?
The IUPAC name of (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one (CID 95157382) is (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one.
What is the SMILES notation for (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one?
The canonical SMILES for (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one is C[C@H]1C(=O)NCCN1Cc1nnc(C(C)(C)C)o1.
What is the InChIKey of (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one?
The InChIKey is XGNVYBOVWUJOIX-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H20N4O2/c1-8-10(17)13-5-6-16(8)7-9-14-15-11(18-9)12(2,3)4/h8H,5-7H2,1-4H3,(H,13,17)/t8-/m0/s1.
What are the key properties of (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one?
(3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one has a molecular weight of 252.32 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)methyl]-3-methylpiperazin-2-one is sourced from PubChem (CID 95157382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).