C13H19N5O3 — CID 95157777
(2R)-N-carbamoyl-2-[methyl-[2-[(6-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]propanamide (PubChem CID 95157777) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is (2R)-N-carbamoyl-2-[methyl-[2-[(6-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]propanamide.
| Compound Name | (2R)-N-carbamoyl-2-[methyl-[2-[(6-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 95157777 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (2R)-N-carbamoyl-2-[methyl-[2-[(6-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]propanamide |
| SMILES | Cc1cccc(NC(=O)CN(C)[C@H](C)C(=O)NC(N)=O)n1 |
| InChI | InChI=1S/C13H19N5O3/c1-8-5-4-6-10(15-8)16-11(19)7-18(3)9(2)12(20)17-13(14)21/h4-6,9H,7H2,1-3H3,(H,15,16,19)(H3,14,17,20,21)/t9-/m1/s1 |
| InChIKey | LIJKBBVAXHZDFU-SECBINFHSA-N |
| XLogP | -0.16 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |