C19H22N4O2 — CID 95158638
(4R)-1-phenyl-4-[(3R)-3-pyrazol-1-ylpiperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 95158638) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (4R)-1-phenyl-4-[(3R)-3-pyrazol-1-ylpiperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (4R)-1-phenyl-4-[(3R)-3-pyrazol-1-ylpiperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 95158638 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (4R)-1-phenyl-4-[(3R)-3-pyrazol-1-ylpiperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C([C@@H]1CC(=O)N(c2ccccc2)C1)N1CCC[C@@H](n2cccn2)C1 |
| InChI | InChI=1S/C19H22N4O2/c24-18-12-15(13-22(18)16-6-2-1-3-7-16)19(25)21-10-4-8-17(14-21)23-11-5-9-20-23/h1-3,5-7,9,11,15,17H,4,8,10,12-14H2/t15-,17-/m1/s1 |
| InChIKey | LTTBQLKBTBMKQQ-NVXWUHKLSA-N |
| XLogP | 2.10 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |