C11H11FO2S — CID 95159541
(3S,5R)-3-(2-fluorophenyl)sulfanyl-5-methyloxolan-2-one (PubChem CID 95159541) has the molecular formula C11H11FO2S and a molecular weight of 226.27 g/mol. Its IUPAC name is (3S,5R)-3-(2-fluorophenyl)sulfanyl-5-methyloxolan-2-one.
| Compound Name | (3S,5R)-3-(2-fluorophenyl)sulfanyl-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 95159541 |
| Molecular Formula | C11H11FO2S |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (3S,5R)-3-(2-fluorophenyl)sulfanyl-5-methyloxolan-2-one |
| SMILES | C[C@@H]1C[C@H](Sc2ccccc2F)C(=O)O1 |
| InChI | InChI=1S/C11H11FO2S/c1-7-6-10(11(13)14-7)15-9-5-3-2-4-8(9)12/h2-5,7,10H,6H2,1H3/t7-,10+/m1/s1 |
| InChIKey | BXCWIZOFEGMQNH-XCBNKYQSSA-N |
| XLogP | 2.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |