C21H20N4O3 — CID 95163705
1-[(1S)-1-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]ethyl]-3-quinolin-8-ylurea (PubChem CID 95163705) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 1-[(1S)-1-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]ethyl]-3-quinolin-8-ylurea.
| Compound Name | 1-[(1S)-1-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]ethyl]-3-quinolin-8-ylurea |
|---|---|
| PubChem CID | 95163705 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1-[(1S)-1-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]ethyl]-3-quinolin-8-ylurea |
| SMILES | C[C@H](NC(=O)Nc1cccc2cccnc12)c1cccc(N2CCOC2=O)c1 |
| InChI | InChI=1S/C21H20N4O3/c1-14(16-6-2-8-17(13-16)25-11-12-28-21(25)27)23-20(26)24-18-9-3-5-15-7-4-10-22-19(15)18/h2-10,13-14H,11-12H2,1H3,(H2,23,24,26)/t14-/m0/s1 |
| InChIKey | RKCHMSZESLKSMI-AWEZNQCLSA-N |
| XLogP | 4.07 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |