C14H14N2O3S — CID 951661
(5Z)-1-cyclopentyl-5-(thiophen-2-ylmethylidene)-1,3-diazinane-2,4,6-trione (PubChem CID 951661) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is (5Z)-1-cyclopentyl-5-(thiophen-2-ylmethylidene)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-cyclopentyl-5-(thiophen-2-ylmethylidene)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 951661 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | (5Z)-1-cyclopentyl-5-(thiophen-2-ylmethylidene)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(C2CCCC2)C(=O)/C1=C\c1cccs1 |
| InChI | InChI=1S/C14H14N2O3S/c17-12-11(8-10-6-3-7-20-10)13(18)16(14(19)15-12)9-4-1-2-5-9/h3,6-9H,1-2,4-5H2,(H,15,17,19)/b11-8- |
| InChIKey | LZMWGBKYNHCFQU-FLIBITNWSA-N |
| XLogP | 2.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|