About 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile
2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile (PubChem CID 95166670) has the molecular formula C13H7FN4O
and a molecular weight of 254.22 g/mol. Its IUPAC name is 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile |
| PubChem CID | 95166670 |
| Molecular Formula | C13H7FN4O |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C(N)[C@@]1(C#N)O[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H7FN4O/c14-10-3-1-8(2-4-10)12-13(7-17,19-12)11(18)9(5-15)6-16/h1-4,12H,18H2/t12-,13-/m1/s1 |
| InChIKey | FBMSASBUAQECSA-CHWSQXEVSA-N |
| XLogP | 1.42 |
| TPSA | 109.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile?
The IUPAC name of 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile (CID 95166670) is 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile.
What is the SMILES notation for 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile?
The canonical SMILES for 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile is N#CC(C#N)=C(N)[C@@]1(C#N)O[C@@H]1c1ccc(F)cc1.
What is the InChIKey of 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile?
The InChIKey is FBMSASBUAQECSA-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H7FN4O/c14-10-3-1-8(2-4-10)12-13(7-17,19-12)11(18)9(5-15)6-16/h1-4,12H,18H2/t12-,13-/m1/s1.
What are the key properties of 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile?
2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile has a molecular weight of 254.22 g/mol, XLogP of 1.42, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino-[(2S,3R)-2-cyano-3-(4-fluorophenyl)oxiran-2-yl]methylidene]propanedinitrile is sourced from PubChem (CID 95166670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).