About (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile
(2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile (PubChem CID 95166750) has the molecular formula C19H17NO6
and a molecular weight of 355.35 g/mol. Its IUPAC name is (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile.
Molecular Properties
| Compound Name | (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile |
| PubChem CID | 95166750 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile |
| SMILES | COc1ccc([C@H](C#N)C(=O)c2cc3c(c(OC)c2OC)OCO3)cc1 |
| InChI | InChI=1S/C19H17NO6/c1-22-12-6-4-11(5-7-12)14(9-20)16(21)13-8-15-18(26-10-25-15)19(24-3)17(13)23-2/h4-8,14H,10H2,1-3H3/t14-/m0/s1 |
| InChIKey | KKLWXEUOUZMAGG-AWEZNQCLSA-N |
| XLogP | 2.93 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile?
The IUPAC name of (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile (CID 95166750) is (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile.
What is the SMILES notation for (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile?
The canonical SMILES for (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile is COc1ccc([C@H](C#N)C(=O)c2cc3c(c(OC)c2OC)OCO3)cc1.
What is the InChIKey of (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile?
The InChIKey is KKLWXEUOUZMAGG-AWEZNQCLSA-N. The full InChI is InChI=1S/C19H17NO6/c1-22-12-6-4-11(5-7-12)14(9-20)16(21)13-8-15-18(26-10-25-15)19(24-3)17(13)23-2/h4-8,14H,10H2,1-3H3/t14-/m0/s1.
What are the key properties of (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile?
(2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile has a molecular weight of 355.35 g/mol, XLogP of 2.93, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)-2-(4-methoxyphenyl)-3-oxopropanenitrile is sourced from PubChem (CID 95166750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).