C22H19ClN2O6S — CID 95167141
(7S)-4-(3-chlorophenyl)-7-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-3-methyl-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-2,5-dione (PubChem CID 95167141) has the molecular formula C22H19ClN2O6S and a molecular weight of 474.92 g/mol. Its IUPAC name is (7S)-4-(3-chlorophenyl)-7-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-3-methyl-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-2,5-dione.
| Compound Name | (7S)-4-(3-chlorophenyl)-7-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-3-methyl-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 95167141 |
| Molecular Formula | C22H19ClN2O6S |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | (7S)-4-(3-chlorophenyl)-7-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-3-methyl-6,7-dihydro-[1,3]thiazolo[4,5-b]pyridine-2,5-dione |
| SMILES | COc1cc([C@@H]2CC(=O)N(c3cccc(Cl)c3)c3c2sc(=O)n3C)c(OC)c2c1OCO2 |
| InChI | InChI=1S/C22H19ClN2O6S/c1-24-21-20(32-22(24)27)14(9-16(26)25(21)12-6-4-5-11(23)7-12)13-8-15(28-2)18-19(17(13)29-3)31-10-30-18/h4-8,14H,9-10H2,1-3H3/t14-/m0/s1 |
| InChIKey | RHEKCMDDHHFBNO-AWEZNQCLSA-N |
| XLogP | 4.05 |
| TPSA | 79.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |