C21H38N2O4 — CID 95169717
tert-butyl N-[[(3S)-1-[(2S)-2-but-3-enoxypropanoyl]piperidin-3-yl]methyl]-N-propan-2-ylcarbamate (PubChem CID 95169717) has the molecular formula C21H38N2O4 and a molecular weight of 382.55 g/mol. Its IUPAC name is tert-butyl N-[[(3S)-1-[(2S)-2-but-3-enoxypropanoyl]piperidin-3-yl]methyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[[(3S)-1-[(2S)-2-but-3-enoxypropanoyl]piperidin-3-yl]methyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 95169717 |
| Molecular Formula | C21H38N2O4 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | tert-butyl N-[[(3S)-1-[(2S)-2-but-3-enoxypropanoyl]piperidin-3-yl]methyl]-N-propan-2-ylcarbamate |
| SMILES | C=CCCO[C@@H](C)C(=O)N1CCC[C@H](CN(C(=O)OC(C)(C)C)C(C)C)C1 |
| InChI | InChI=1S/C21H38N2O4/c1-8-9-13-26-17(4)19(24)22-12-10-11-18(14-22)15-23(16(2)3)20(25)27-21(5,6)7/h8,16-18H,1,9-15H2,2-7H3/t17-,18-/m0/s1 |
| InChIKey | MEMRTZIWYVZAMA-ROUUACIJSA-N |
| XLogP | 3.85 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|