C13H17BrN6OS — CID 95170267
2-[[5-[(1R)-1-(4-bromoanilino)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide (PubChem CID 95170267) has the molecular formula C13H17BrN6OS and a molecular weight of 385.29 g/mol. Its IUPAC name is 2-[[5-[(1R)-1-(4-bromoanilino)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide.
| Compound Name | 2-[[5-[(1R)-1-(4-bromoanilino)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 95170267 |
| Molecular Formula | C13H17BrN6OS |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2-[[5-[(1R)-1-(4-bromoanilino)ethyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide |
| SMILES | C[C@@H](Nc1ccc(Br)cc1)c1nnc(SCC(=O)NN)n1C |
| InChI | InChI=1S/C13H17BrN6OS/c1-8(16-10-5-3-9(14)4-6-10)12-18-19-13(20(12)2)22-7-11(21)17-15/h3-6,8,16H,7,15H2,1-2H3,(H,17,21)/t8-/m1/s1 |
| InChIKey | CHNVIXIEOCXJDS-MRVPVSSYSA-N |
| XLogP | 1.83 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|